About 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone
1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone (PubChem CID 2133895) has the molecular formula C13H16Cl2N2O
and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone.
Molecular Properties
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone |
| PubChem CID | 2133895 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone |
| SMILES | O=C(C(Cl)Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-12(15)13(18)17-8-6-16(7-9-17)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | RWMOOKHKAKFYGK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone?
The IUPAC name of 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone (CID 2133895) is 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone.
What is the SMILES notation for 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone?
The canonical SMILES for 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone is O=C(C(Cl)Cl)N1CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone?
The InChIKey is RWMOOKHKAKFYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N2O/c14-12(15)13(18)17-8-6-16(7-9-17)10-11-4-2-1-3-5-11/h1-5,12H,6-10H2.
What are the key properties of 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone?
1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone has a molecular weight of 287.19 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylpiperazin-1-yl)-2,2-dichloroethanone is sourced from PubChem (CID 2133895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).