C31H30Cl4N2O12 — CID 21339711
[(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[3-(phenylmethoxycarbonylamino)propoxy]-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 21339711) has the molecular formula C31H30Cl4N2O12 and a molecular weight of 764.39 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[3-(phenylmethoxycarbonylamino)propoxy]-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[3-(phenylmethoxycarbonylamino)propoxy]-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 21339711 |
| Molecular Formula | C31H30Cl4N2O12 |
| Molecular Weight | 764.39 g/mol |
| Exact Mass | 762.06 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-diacetyloxy-6-[3-(phenylmethoxycarbonylamino)propoxy]-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCCNC(=O)OCc2ccccc2)[C@H](N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H30Cl4N2O12/c1-14(38)45-13-18-26(47-15(2)39)27(48-16(3)40)25(37-28(41)19-20(29(37)42)22(33)24(35)23(34)21(19)32)30(49-18)44-11-7-10-36-31(43)46-12-17-8-5-4-6-9-17/h4-6,8-9,18,25-27,30H,7,10-13H2,1-3H3,(H,36,43)/t18-,25-,26-,27-,30-/m1/s1 |
| InChIKey | DZXZFOGVMLLRTM-GOYZUBTFSA-N |
| XLogP | 4.75 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|