About (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate
(1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate (PubChem CID 21339990) has the molecular formula C22H38O2
and a molecular weight of 334.54 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate |
| PubChem CID | 21339990 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate |
| SMILES | CCC1(OC(=O)CCCCC2CC3CC2C(C)(C)C3C)CCCC1 |
| InChI | InChI=1S/C22H38O2/c1-5-22(12-8-9-13-22)24-20(23)11-7-6-10-17-14-18-15-19(17)21(3,4)16(18)2/h16-19H,5-15H2,1-4H3 |
| InChIKey | JYHOGRZRZLHYFP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate?
The IUPAC name of (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate (CID 21339990) is (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate.
What is the SMILES notation for (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate?
The canonical SMILES for (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate is CCC1(OC(=O)CCCCC2CC3CC2C(C)(C)C3C)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate?
The InChIKey is JYHOGRZRZLHYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O2/c1-5-22(12-8-9-13-22)24-20(23)11-7-6-10-17-14-18-15-19(17)21(3,4)16(18)2/h16-19H,5-15H2,1-4H3.
What are the key properties of (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate?
(1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate has a molecular weight of 334.54 g/mol, XLogP of 6.13, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 5-(5,6,6-trimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate is sourced from PubChem (CID 21339990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).