C36H44F3N5O4S — CID 21340144
(2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-piperidin-1-ylphenyl]-6-(trifluoromethyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 21340144) has the molecular formula C36H44F3N5O4S and a molecular weight of 699.84 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-piperidin-1-ylphenyl]-6-(trifluoromethyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-piperidin-1-ylphenyl]-6-(trifluoromethyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 21340144 |
| Molecular Formula | C36H44F3N5O4S |
| Molecular Weight | 699.84 g/mol |
| Exact Mass | 699.31 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-piperidin-1-ylphenyl]-6-(trifluoromethyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | CCc1ccc(C)cc1OS(=O)Nc1cc(-c2nc3c(C(=O)OC4C(C)CC(C)CC4C)c(C(F)(F)F)cn3[nH]2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C36H44F3N5O4S/c1-6-25-11-10-21(2)18-30(25)48-49(46)42-28-19-26(12-13-29(28)43-14-8-7-9-15-43)33-40-34-31(27(36(37,38)39)20-44(34)41-33)35(45)47-32-23(4)16-22(3)17-24(32)5/h10-13,18-20,22-24,32,42H,6-9,14-17H2,1-5H3,(H,40,41) |
| InChIKey | FIVNBIBYKFIUJW-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.84 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |