C37H44ClN7O5S — CID 21340161
(2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2-ethyl-5-methylphenoxy)sulfinylamino]phenyl]-5-chloro-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 21340161) has the molecular formula C37H44ClN7O5S and a molecular weight of 734.32 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2-ethyl-5-methylphenoxy)sulfinylamino]phenyl]-5-chloro-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2-ethyl-5-methylphenoxy)sulfinylamino]phenyl]-5-chloro-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 21340161 |
| Molecular Formula | C37H44ClN7O5S |
| Molecular Weight | 734.32 g/mol |
| Exact Mass | 733.28 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[4-(4-acetylpiperazin-1-yl)-3-[(2-ethyl-5-methylphenoxy)sulfinylamino]phenyl]-5-chloro-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(N4CCN(C(C)=O)CC4)c(NS(=O)Oc4cc(C)ccc4CC)c3)[nH]n2c1Cl |
| InChI | InChI=1S/C37H44ClN7O5S/c1-8-26-10-9-21(2)19-30(26)50-51(48)42-28-20-27(11-12-29(28)44-15-13-43(14-16-44)25(6)46)35-40-36-31(32(39-7)34(38)45(36)41-35)37(47)49-33-23(4)17-22(3)18-24(33)5/h9-12,19-20,22-24,33,42H,8,13-18H2,1-6H3,(H,40,41) |
| InChIKey | GHIBAJHFGCTWDG-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.32 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|