About (4R)-1,3-thiazolidine-4-carboxamide
(4R)-1,3-thiazolidine-4-carboxamide (PubChem CID 21340288) has the molecular formula C4H8N2OS
and a molecular weight of 132.19 g/mol. Its IUPAC name is (4R)-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | (4R)-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 21340288 |
| Molecular Formula | C4H8N2OS |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (4R)-1,3-thiazolidine-4-carboxamide |
| SMILES | NC(=O)[C@@H]1CSCN1 |
| InChI | InChI=1S/C4H8N2OS/c5-4(7)3-1-8-2-6-3/h3,6H,1-2H2,(H2,5,7)/t3-/m0/s1 |
| InChIKey | AIOMGEMZFLRFJE-VKHMYHEASA-N |
| XLogP | -0.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,3-thiazolidine-4-carboxamide?
The IUPAC name of (4R)-1,3-thiazolidine-4-carboxamide (CID 21340288) is (4R)-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for (4R)-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for (4R)-1,3-thiazolidine-4-carboxamide is NC(=O)[C@@H]1CSCN1.
What is the InChIKey of (4R)-1,3-thiazolidine-4-carboxamide?
The InChIKey is AIOMGEMZFLRFJE-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8N2OS/c5-4(7)3-1-8-2-6-3/h3,6H,1-2H2,(H2,5,7)/t3-/m0/s1.
What are the key properties of (4R)-1,3-thiazolidine-4-carboxamide?
(4R)-1,3-thiazolidine-4-carboxamide has a molecular weight of 132.19 g/mol, XLogP of -0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 21340288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).