C22H14ClF2N3O4 — CID 2134033
(5S)-4-(5-chloro-2-nitrobenzoyl)-7-fluoro-5-(4-fluorophenyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 2134033) has the molecular formula C22H14ClF2N3O4 and a molecular weight of 457.82 g/mol. Its IUPAC name is (5S)-4-(5-chloro-2-nitrobenzoyl)-7-fluoro-5-(4-fluorophenyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | (5S)-4-(5-chloro-2-nitrobenzoyl)-7-fluoro-5-(4-fluorophenyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 2134033 |
| Molecular Formula | C22H14ClF2N3O4 |
| Molecular Weight | 457.82 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (5S)-4-(5-chloro-2-nitrobenzoyl)-7-fluoro-5-(4-fluorophenyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(Cl)ccc2[N+](=O)[O-])[C@@H](c2ccc(F)cc2)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C22H14ClF2N3O4/c23-13-3-8-19(28(31)32)17(9-13)22(30)27-11-20(29)26-18-7-6-15(25)10-16(18)21(27)12-1-4-14(24)5-2-12/h1-10,21H,11H2,(H,26,29)/t21-/m0/s1 |
| InChIKey | CGTYTXQWWXYVGZ-NRFANRHFSA-N |
| XLogP | 4.71 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|