C13H16FN5S — CID 21340376
6-(1-fluoroethyl)-2-N-(1-phenylethylsulfanyl)-1,3,5-triazine-2,4-diamine (PubChem CID 21340376) has the molecular formula C13H16FN5S and a molecular weight of 293.37 g/mol. Its IUPAC name is 6-(1-fluoroethyl)-2-N-(1-phenylethylsulfanyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1-fluoroethyl)-2-N-(1-phenylethylsulfanyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21340376 |
| Molecular Formula | C13H16FN5S |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6-(1-fluoroethyl)-2-N-(1-phenylethylsulfanyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(F)c1nc(N)nc(NSC(C)c2ccccc2)n1 |
| InChI | InChI=1S/C13H16FN5S/c1-8(14)11-16-12(15)18-13(17-11)19-20-9(2)10-6-4-3-5-7-10/h3-9H,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | WTVYAJKETNXKSY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|