C10H24N4+2 — CID 21340611
3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propanimidamide (PubChem CID 21340611) has the molecular formula C10H24N4+2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propanimidamide.
| Compound Name | 3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propanimidamide |
|---|---|
| PubChem CID | 21340611 |
| Molecular Formula | C10H24N4+2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | 3-(1,4,4-trimethylpiperazine-1,4-diium-1-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CC[N+]1(C)CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C10H24N4/c1-13(2)6-8-14(3,9-7-13)5-4-10(11)12/h4-9H2,1-3H3,(H3,11,12)/q+2 |
| InChIKey | WTYFANHRFXHGKA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|