About (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid
(2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid (PubChem CID 21341070) has the molecular formula C7H11F3O4S
and a molecular weight of 248.22 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid.
Molecular Properties
| Compound Name | (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid |
| PubChem CID | 21341070 |
| Molecular Formula | C7H11F3O4S |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid |
| SMILES | CC(C)(C)[C@@H](C(=O)O)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O4S/c1-6(2,3)4(5(11)12)15(13,14)7(8,9)10/h4H,1-3H3,(H,11,12)/t4-/m1/s1 |
| InChIKey | MUJKJDBUZMCIOP-SCSAIBSYSA-N |
| XLogP | 1.42 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid?
The IUPAC name of (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid (CID 21341070) is (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid.
What is the SMILES notation for (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid?
The canonical SMILES for (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid is CC(C)(C)[C@@H](C(=O)O)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid?
The InChIKey is MUJKJDBUZMCIOP-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H11F3O4S/c1-6(2,3)4(5(11)12)15(13,14)7(8,9)10/h4H,1-3H3,(H,11,12)/t4-/m1/s1.
What are the key properties of (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid?
(2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid has a molecular weight of 248.22 g/mol, XLogP of 1.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3,3-dimethyl-2-(trifluoromethylsulfonyl)butanoic acid is sourced from PubChem (CID 21341070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).