C27H23F2N3O — CID 21341388
(E)-N-[4-[2-(aminomethyl)phenyl]-2-fluorophenyl]-2-fluoro-3-(1-methylisoquinolin-7-yl)but-2-enamide (PubChem CID 21341388) has the molecular formula C27H23F2N3O and a molecular weight of 443.50 g/mol. Its IUPAC name is (E)-N-[4-[2-(aminomethyl)phenyl]-2-fluorophenyl]-2-fluoro-3-(1-methylisoquinolin-7-yl)but-2-enamide.
| Compound Name | (E)-N-[4-[2-(aminomethyl)phenyl]-2-fluorophenyl]-2-fluoro-3-(1-methylisoquinolin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 21341388 |
| Molecular Formula | C27H23F2N3O |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (E)-N-[4-[2-(aminomethyl)phenyl]-2-fluorophenyl]-2-fluoro-3-(1-methylisoquinolin-7-yl)but-2-enamide |
| SMILES | C/C(=C(\F)C(=O)Nc1ccc(-c2ccccc2CN)cc1F)c1ccc2ccnc(C)c2c1 |
| InChI | InChI=1S/C27H23F2N3O/c1-16(19-8-7-18-11-12-31-17(2)23(18)13-19)26(29)27(33)32-25-10-9-20(14-24(25)28)22-6-4-3-5-21(22)15-30/h3-14H,15,30H2,1-2H3,(H,32,33)/b26-16+ |
| InChIKey | BWMSPNWIJNWJRJ-WGOQTCKBSA-N |
| XLogP | 6.15 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|