C22H22N2+2 — CID 21342209
1,8-dimethyl-1,3-diphenyl-2H-quinazoline-1,3-diium (PubChem CID 21342209) has the molecular formula C22H22N2+2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1,8-dimethyl-1,3-diphenyl-2H-quinazoline-1,3-diium.
| Compound Name | 1,8-dimethyl-1,3-diphenyl-2H-quinazoline-1,3-diium |
|---|---|
| PubChem CID | 21342209 |
| Molecular Formula | C22H22N2+2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1,8-dimethyl-1,3-diphenyl-2H-quinazoline-1,3-diium |
| SMILES | Cc1cccc2c1[N+](C)(c1ccccc1)C[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C22H22N2/c1-18-10-9-11-19-16-23(20-12-5-3-6-13-20)17-24(2,22(18)19)21-14-7-4-8-15-21/h3-16H,17H2,1-2H3/q+2 |
| InChIKey | DMHIOQURWALKDE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|