C34H26N2OS+2 — CID 21342693
8'-methyl-3,3',8-triphenylspiro[1,3-benzothiazin-3-ium-2,2'-1,3-benzoxazin-3-ium] (PubChem CID 21342693) has the molecular formula C34H26N2OS+2 and a molecular weight of 510.66 g/mol. Its IUPAC name is 8'-methyl-3,3',8-triphenylspiro[1,3-benzothiazin-3-ium-2,2'-1,3-benzoxazin-3-ium].
| Compound Name | 8'-methyl-3,3',8-triphenylspiro[1,3-benzothiazin-3-ium-2,2'-1,3-benzoxazin-3-ium] |
|---|---|
| PubChem CID | 21342693 |
| Molecular Formula | C34H26N2OS+2 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 8'-methyl-3,3',8-triphenylspiro[1,3-benzothiazin-3-ium-2,2'-1,3-benzoxazin-3-ium] |
| SMILES | Cc1cccc2c1OC1(Sc3c(cccc3-c3ccccc3)C=[N+]1c1ccccc1)[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C34H26N2OS/c1-25-13-11-16-27-23-35(29-18-7-3-8-19-29)34(37-32(25)27)36(30-20-9-4-10-21-30)24-28-17-12-22-31(33(28)38-34)26-14-5-2-6-15-26/h2-24H,1H3/q+2 |
| InChIKey | GJULRKVXNVGLOR-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 15.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|