C28H22N2S2+2 — CID 21342699
8'-methyl-3,3'-diphenyl-2,2'-spirobi[1,3-benzothiazin-3-ium] (PubChem CID 21342699) has the molecular formula C28H22N2S2+2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 8'-methyl-3,3'-diphenyl-2,2'-spirobi[1,3-benzothiazin-3-ium].
| Compound Name | 8'-methyl-3,3'-diphenyl-2,2'-spirobi[1,3-benzothiazin-3-ium] |
|---|---|
| PubChem CID | 21342699 |
| Molecular Formula | C28H22N2S2+2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 8'-methyl-3,3'-diphenyl-2,2'-spirobi[1,3-benzothiazin-3-ium] |
| SMILES | Cc1cccc2c1SC1(Sc3ccccc3C=[N+]1c1ccccc1)[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C28H22N2S2/c1-21-11-10-13-23-20-30(25-16-6-3-7-17-25)28(32-27(21)23)29(24-14-4-2-5-15-24)19-22-12-8-9-18-26(22)31-28/h2-20H,1H3/q+2 |
| InChIKey | AKAWLCDNIDXXKG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|