About methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane
methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane (PubChem CID 21342919) has the molecular formula C26H24NSSi+
and a molecular weight of 410.64 g/mol. Its IUPAC name is methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane.
Molecular Properties
| Compound Name | methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane |
| PubChem CID | 21342919 |
| Molecular Formula | C26H24NSSi+ |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane |
| SMILES | Cc1cccc2[n+]1CSc1c-2cccc1[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24NSSi/c1-20-11-9-17-24-23-16-10-18-25(26(23)28-19-27(20)24)29(2,21-12-5-3-6-13-21)22-14-7-4-8-15-22/h3-18H,19H2,1-2H3/q+1 |
| InChIKey | YFTRTLBIYRIODU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane?
The IUPAC name of methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane (CID 21342919) is methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane.
What is the SMILES notation for methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane?
The canonical SMILES for methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane is Cc1cccc2[n+]1CSc1c-2cccc1[Si](C)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane?
The InChIKey is YFTRTLBIYRIODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24NSSi/c1-20-11-9-17-24-23-16-10-18-25(26(23)28-19-27(20)24)29(2,21-12-5-3-6-13-21)22-14-7-4-8-15-22/h3-18H,19H2,1-2H3/q+1.
What are the key properties of methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane?
methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane has a molecular weight of 410.64 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(8-methyl-6H-pyrido[1,2-c][1,3]benzothiazin-7-ium-4-yl)-diphenylsilane is sourced from PubChem (CID 21342919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).