About 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane
2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 21343480) has the molecular formula C12H14BNO2
and a molecular weight of 215.06 g/mol. Its IUPAC name is 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
Molecular Properties
| Compound Name | 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| PubChem CID | 21343480 |
| Molecular Formula | C12H14BNO2 |
| Molecular Weight | 215.06 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | [C-]#[N+]c1ccc(B2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C12H14BNO2/c1-12(2)8-15-13(16-9-12)10-4-6-11(14-3)7-5-10/h4-7H,8-9H2,1-2H3 |
| InChIKey | UCGJGAAFAVVZPC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane?
The IUPAC name of 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CID 21343480) is 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
What is the SMILES notation for 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane?
The canonical SMILES for 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane is [C-]#[N+]c1ccc(B2OCC(C)(C)CO2)cc1.
What is the InChIKey of 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane?
The InChIKey is UCGJGAAFAVVZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BNO2/c1-12(2)8-15-13(16-9-12)10-4-6-11(14-3)7-5-10/h4-7H,8-9H2,1-2H3.
What are the key properties of 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane?
2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane has a molecular weight of 215.06 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-isocyanophenyl)-5,5-dimethyl-1,3,2-dioxaborinane is sourced from PubChem (CID 21343480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).