About actinium;1-naphthalen-2-ylethenylazanide
actinium;1-naphthalen-2-ylethenylazanide (PubChem CID 21343658) has the molecular formula C12H10AcN-
and a molecular weight of 395.22 g/mol. Its IUPAC name is actinium;1-naphthalen-2-ylethenylazanide.
Molecular Properties
| Compound Name | actinium;1-naphthalen-2-ylethenylazanide |
|---|
| PubChem CID | 21343658 |
|---|
| Molecular Formula | C12H10AcN- |
|---|
| Molecular Weight | 395.22 g/mol |
|---|
| Exact Mass | 395.11 |
|---|
| IUPAC Name | actinium;1-naphthalen-2-ylethenylazanide |
|---|
| SMILES | C=C([NH-])c1ccc2ccccc2c1.[Ac] |
|---|
| InChI | InChI=1S/C12H10N.Ac/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;/h2-8,13H,1H2;/q-1; |
|---|
| InChIKey | JQKKKVYESALGSE-UHFFFAOYSA-N |
|---|
| XLogP | 3.86 |
|---|
| TPSA | 23.80 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 14 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze actinium;1-naphthalen-2-ylethenylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-naphthalen-2-ylethenylazanide?
The IUPAC name of actinium;1-naphthalen-2-ylethenylazanide (CID 21343658) is actinium;1-naphthalen-2-ylethenylazanide.
What is the SMILES notation for actinium;1-naphthalen-2-ylethenylazanide?
The canonical SMILES for actinium;1-naphthalen-2-ylethenylazanide is C=C([NH-])c1ccc2ccccc2c1.[Ac].
What is the InChIKey of actinium;1-naphthalen-2-ylethenylazanide?
The InChIKey is JQKKKVYESALGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N.Ac/c1-9(13)11-7-6-10-4-2-3-5-12(10)8-11;/h2-8,13H,1H2;/q-1;.
What are the key properties of actinium;1-naphthalen-2-ylethenylazanide?
actinium;1-naphthalen-2-ylethenylazanide has a molecular weight of 395.22 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-naphthalen-2-ylethenylazanide is sourced from PubChem (CID 21343658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).