About 3H-inden-1-amine
3H-inden-1-amine (PubChem CID 21343725) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 3H-inden-1-amine.
Molecular Properties
| Compound Name | 3H-inden-1-amine |
| PubChem CID | 21343725 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 3H-inden-1-amine |
| SMILES | NC1=CCc2ccccc21 |
| InChI | InChI=1S/C9H9N/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,6H,5,10H2 |
| InChIKey | CCSXSLXIPVQFMN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-inden-1-amine?
The IUPAC name of 3H-inden-1-amine (CID 21343725) is 3H-inden-1-amine.
What is the SMILES notation for 3H-inden-1-amine?
The canonical SMILES for 3H-inden-1-amine is NC1=CCc2ccccc21.
What is the InChIKey of 3H-inden-1-amine?
The InChIKey is CCSXSLXIPVQFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,6H,5,10H2.
What are the key properties of 3H-inden-1-amine?
3H-inden-1-amine has a molecular weight of 131.18 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-inden-1-amine is sourced from PubChem (CID 21343725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).