C20H21F2N5O5S — CID 21343996
(E)-N-(diaminomethylidene)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide (PubChem CID 21343996) has the molecular formula C20H21F2N5O5S and a molecular weight of 481.48 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 21343996 |
| Molecular Formula | C20H21F2N5O5S |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[4-[4-(ethylcarbamoylsulfamoyl)phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide |
| SMILES | CCNC(=O)NS(=O)(=O)c1ccc(Oc2c(F)cc(/C=C(\C)C(=O)N=C(N)N)cc2F)cc1 |
| InChI | InChI=1S/C20H21F2N5O5S/c1-3-25-20(29)27-33(30,31)14-6-4-13(5-7-14)32-17-15(21)9-12(10-16(17)22)8-11(2)18(28)26-19(23)24/h4-10H,3H2,1-2H3,(H2,25,27,29)(H4,23,24,26,28)/b11-8+ |
| InChIKey | STZZPTXWCUAQQK-DHZHZOJOSA-N |
| XLogP | 1.97 |
| TPSA | 165.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|