prop-2-enyl 4-cyano-4-methylpentanoate

C10H15NO2 — CID 21344082

IUPACprop-2-enyl 4-cyano-4-methylpentanoate
SMILESC=CCOC(=O)CCC(C)(C)C#N
InChIInChI=1S/C10H15NO2/c1-4-7-13-9(12)5-6-10(2,3)8-11/h4H,1,5-7H2,2-3H3
InChIKeyYKSGWZBFLHNEHE-UHFFFAOYSA-N
MW181.23 g/mol
LogP2.05
Rot. Bonds5

About prop-2-enyl 4-cyano-4-methylpentanoate

prop-2-enyl 4-cyano-4-methylpentanoate (PubChem CID 21344082) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is prop-2-enyl 4-cyano-4-methylpentanoate.

Molecular Properties

Compound Nameprop-2-enyl 4-cyano-4-methylpentanoate
PubChem CID21344082
Molecular FormulaC10H15NO2
Molecular Weight181.23 g/mol
Exact Mass181.11
IUPAC Nameprop-2-enyl 4-cyano-4-methylpentanoate
SMILESC=CCOC(=O)CCC(C)(C)C#N
InChIInChI=1S/C10H15NO2/c1-4-7-13-9(12)5-6-10(2,3)8-11/h4H,1,5-7H2,2-3H3
InChIKeyYKSGWZBFLHNEHE-UHFFFAOYSA-N
XLogP2.05
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.23
LogP ≤ 52.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze prop-2-enyl 4-cyano-4-methylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of prop-2-enyl 4-cyano-4-methylpentanoate?
The IUPAC name of prop-2-enyl 4-cyano-4-methylpentanoate (CID 21344082) is prop-2-enyl 4-cyano-4-methylpentanoate.
What is the SMILES notation for prop-2-enyl 4-cyano-4-methylpentanoate?
The canonical SMILES for prop-2-enyl 4-cyano-4-methylpentanoate is C=CCOC(=O)CCC(C)(C)C#N.
What is the InChIKey of prop-2-enyl 4-cyano-4-methylpentanoate?
The InChIKey is YKSGWZBFLHNEHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-4-7-13-9(12)5-6-10(2,3)8-11/h4H,1,5-7H2,2-3H3.
What are the key properties of prop-2-enyl 4-cyano-4-methylpentanoate?
prop-2-enyl 4-cyano-4-methylpentanoate has a molecular weight of 181.23 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 4-cyano-4-methylpentanoate is sourced from PubChem (CID 21344082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).