C52H60N2O6 — CID 21344091
2-[4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexyl]-5-[4-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]butyl]isoindole-1,3-dione (PubChem CID 21344091) has the molecular formula C52H60N2O6 and a molecular weight of 809.06 g/mol. Its IUPAC name is 2-[4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexyl]-5-[4-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexyl]-5-[4-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21344091 |
| Molecular Formula | C52H60N2O6 |
| Molecular Weight | 809.06 g/mol |
| Exact Mass | 808.45 |
| IUPAC Name | 2-[4-[2-(4-methylcyclohexyl)propan-2-yl]cyclohexyl]-5-[4-[4-[2-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxyphenyl]propan-2-yl]phenoxy]butyl]isoindole-1,3-dione |
| SMILES | CC1CCC(C(C)(C)C2CCC(N3C(=O)c4ccc(CCCCOc5ccc(C(C)(C)c6ccc(Oc7ccc8c(c7)C(=O)N(C)C8=O)cc6)cc5)cc4C3=O)CC2)CC1 |
| InChI | InChI=1S/C52H60N2O6/c1-33-10-13-35(14-11-33)51(2,3)36-15-21-39(22-16-36)54-49(57)44-28-12-34(31-45(44)50(54)58)9-7-8-30-59-40-23-17-37(18-24-40)52(4,5)38-19-25-41(26-20-38)60-42-27-29-43-46(32-42)48(56)53(6)47(43)55/h12,17-20,23-29,31-33,35-36,39H,7-11,13-16,21-22,30H2,1-6H3 |
| InChIKey | KSRVONYWVOPTMY-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.06 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|