About (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate
(9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate (PubChem CID 21344451) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate |
| PubChem CID | 21344451 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1C(O)C2CC1C1CCCC21 |
| InChI | InChI=1S/C15H24O3/c1-3-8(2)15(17)18-14-12-7-11(13(14)16)9-5-4-6-10(9)12/h8-14,16H,3-7H2,1-2H3 |
| InChIKey | REMCKHRGNITQHH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate?
The IUPAC name of (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate (CID 21344451) is (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate.
What is the SMILES notation for (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate?
The canonical SMILES for (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate is CCC(C)C(=O)OC1C(O)C2CC1C1CCCC21.
What is the InChIKey of (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate?
The InChIKey is REMCKHRGNITQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-8(2)15(17)18-14-12-7-11(13(14)16)9-5-4-6-10(9)12/h8-14,16H,3-7H2,1-2H3.
What are the key properties of (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate?
(9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate has a molecular weight of 252.35 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylbutanoate is sourced from PubChem (CID 21344451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).