About [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate
[2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate (PubChem CID 21344693) has the molecular formula C20H20O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate.
Molecular Properties
| Compound Name | [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate |
| PubChem CID | 21344693 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(C)cc1C1C(=O)Oc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C20H20O4/c1-10-6-12(3)18(23-14(5)21)15(8-10)17-16-9-11(2)7-13(4)19(16)24-20(17)22/h6-9,17H,1-5H3 |
| InChIKey | AEGGFTCUAZDCGC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate?
The IUPAC name of [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate (CID 21344693) is [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate.
What is the SMILES notation for [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate?
The canonical SMILES for [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate is CC(=O)Oc1c(C)cc(C)cc1C1C(=O)Oc2c(C)cc(C)cc21.
What is the InChIKey of [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate?
The InChIKey is AEGGFTCUAZDCGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O4/c1-10-6-12(3)18(23-14(5)21)15(8-10)17-16-9-11(2)7-13(4)19(16)24-20(17)22/h6-9,17H,1-5H3.
What are the key properties of [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate?
[2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate has a molecular weight of 324.38 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5,7-dimethyl-2-oxo-3H-1-benzofuran-3-yl)-4,6-dimethylphenyl] acetate is sourced from PubChem (CID 21344693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).