C16H34O — CID 21344764
2,3,4,5,6,7,8-heptamethylnonan-5-ol (PubChem CID 21344764) has the molecular formula C16H34O and a molecular weight of 242.45 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptamethylnonan-5-ol.
| Compound Name | 2,3,4,5,6,7,8-heptamethylnonan-5-ol |
|---|---|
| PubChem CID | 21344764 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 2,3,4,5,6,7,8-heptamethylnonan-5-ol |
| SMILES | CC(C)C(C)C(C)C(C)(O)C(C)C(C)C(C)C |
| InChI | InChI=1S/C16H34O/c1-10(2)12(5)14(7)16(9,17)15(8)13(6)11(3)4/h10-15,17H,1-9H3 |
| InChIKey | SAUXHNVNNROTOM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |