About 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide
4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide (PubChem CID 21345580) has the molecular formula C18H26N2O4S
and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide.
Molecular Properties
| Compound Name | 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide |
| PubChem CID | 21345580 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide |
| SMILES | NC(=O)C1CC(O)([C@H](C[C@@H](O)CCc2ccccc2)C(N)=O)CCS1 |
| InChI | InChI=1S/C18H26N2O4S/c19-16(22)14(18(24)8-9-25-15(11-18)17(20)23)10-13(21)7-6-12-4-2-1-3-5-12/h1-5,13-15,21,24H,6-11H2,(H2,19,22)(H2,20,23)/t13-,14+,15?,18?/m0/s1 |
| InChIKey | SLQORQFGHHMQJA-JGTPUYEMSA-N |
| XLogP | 0.58 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide?
The IUPAC name of 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide (CID 21345580) is 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide.
What is the SMILES notation for 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide?
The canonical SMILES for 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide is NC(=O)C1CC(O)([C@H](C[C@@H](O)CCc2ccccc2)C(N)=O)CCS1.
What is the InChIKey of 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide?
The InChIKey is SLQORQFGHHMQJA-JGTPUYEMSA-N. The full InChI is InChI=1S/C18H26N2O4S/c19-16(22)14(18(24)8-9-25-15(11-18)17(20)23)10-13(21)7-6-12-4-2-1-3-5-12/h1-5,13-15,21,24H,6-11H2,(H2,19,22)(H2,20,23)/t13-,14+,15?,18?/m0/s1.
What are the key properties of 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide?
4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide has a molecular weight of 366.48 g/mol, XLogP of 0.58, 8 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,4S)-1-amino-4-hydroxy-1-oxo-6-phenylhexan-2-yl]-4-hydroxythiane-2-carboxamide is sourced from PubChem (CID 21345580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).