About 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine
2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine (PubChem CID 21345689) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine |
| PubChem CID | 21345689 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine |
| SMILES | Cc1ccn2c(-c3ccn[nH]3)c(C)nc2c1 |
| InChI | InChI=1S/C12H12N4/c1-8-4-6-16-11(7-8)14-9(2)12(16)10-3-5-13-15-10/h3-7H,1-2H3,(H,13,15) |
| InChIKey | ZNRUSTFXUSPVPD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine?
The IUPAC name of 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine (CID 21345689) is 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine?
The canonical SMILES for 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine is Cc1ccn2c(-c3ccn[nH]3)c(C)nc2c1.
What is the InChIKey of 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine?
The InChIKey is ZNRUSTFXUSPVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c1-8-4-6-16-11(7-8)14-9(2)12(16)10-3-5-13-15-10/h3-7H,1-2H3,(H,13,15).
What are the key properties of 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine?
2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine has a molecular weight of 212.26 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-3-(1H-pyrazol-5-yl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 21345689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).