C24H19F3N4O — CID 21345731
5-[2-(1-phenylethylamino)pyrimidin-4-yl]-6-[3-(trifluoromethyl)phenyl]-1H-pyridin-2-one (PubChem CID 21345731) has the molecular formula C24H19F3N4O and a molecular weight of 436.44 g/mol. Its IUPAC name is 5-[2-(1-phenylethylamino)pyrimidin-4-yl]-6-[3-(trifluoromethyl)phenyl]-1H-pyridin-2-one.
| Compound Name | 5-[2-(1-phenylethylamino)pyrimidin-4-yl]-6-[3-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 21345731 |
| Molecular Formula | C24H19F3N4O |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-[2-(1-phenylethylamino)pyrimidin-4-yl]-6-[3-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
| SMILES | CC(Nc1nccc(-c2ccc(=O)[nH]c2-c2cccc(C(F)(F)F)c2)n1)c1ccccc1 |
| InChI | InChI=1S/C24H19F3N4O/c1-15(16-6-3-2-4-7-16)29-23-28-13-12-20(30-23)19-10-11-21(32)31-22(19)17-8-5-9-18(14-17)24(25,26)27/h2-15H,1H3,(H,31,32)(H,28,29,30) |
| InChIKey | USINECMENRIUJI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |