About 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine
1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine (PubChem CID 21345779) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 21345779 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine |
| SMILES | CSC1=C(C)CN(C)CC1 |
| InChI | InChI=1S/C8H15NS/c1-7-6-9(2)5-4-8(7)10-3/h4-6H2,1-3H3 |
| InChIKey | ZORVLPVBAGLZDQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine (CID 21345779) is 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine is CSC1=C(C)CN(C)CC1.
What is the InChIKey of 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine?
The InChIKey is ZORVLPVBAGLZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-7-6-9(2)5-4-8(7)10-3/h4-6H2,1-3H3.
What are the key properties of 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine?
1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine has a molecular weight of 157.28 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4-methylsulfanyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 21345779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).