C27H33FN2O4S — CID 21346964
2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(furan-2-ylsulfanyl)propyl]piperidin-3-yl]acetic acid (PubChem CID 21346964) has the molecular formula C27H33FN2O4S and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(furan-2-ylsulfanyl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(furan-2-ylsulfanyl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21346964 |
| Molecular Formula | C27H33FN2O4S |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(furan-2-ylsulfanyl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSc4ccco4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H33FN2O4S/c1-33-21-6-8-25-23(17-21)22(9-11-29-25)24(28)7-5-19-10-13-30(18-20(19)16-26(31)32)12-3-15-35-27-4-2-14-34-27/h2,4,6,8-9,11,14,17,19-20,24H,3,5,7,10,12-13,15-16,18H2,1H3,(H,31,32)/t19-,20+,24-/m1/s1 |
| InChIKey | PTRRJDDPSMVQCF-JXALWOEJSA-N |
| XLogP | 6.22 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|