C22H25ClN2O3S — CID 21347880
N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[4-(4-hexa-4,5-dienyl-2-methyl-1,3-dioxolan-2-yl)phenyl]acetamide (PubChem CID 21347880) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[4-(4-hexa-4,5-dienyl-2-methyl-1,3-dioxolan-2-yl)phenyl]acetamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[4-(4-hexa-4,5-dienyl-2-methyl-1,3-dioxolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 21347880 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-thiazol-5-yl)-2-[4-(4-hexa-4,5-dienyl-2-methyl-1,3-dioxolan-2-yl)phenyl]acetamide |
| SMILES | C=C=CCCCC1COC(C)(c2ccc(CC(=O)Nc3snc(C)c3Cl)cc2)O1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-4-5-6-7-8-18-14-27-22(3,28-18)17-11-9-16(10-12-17)13-19(26)24-21-20(23)15(2)25-29-21/h5,9-12,18H,1,6-8,13-14H2,2-3H3,(H,24,26) |
| InChIKey | AIPPXWACVKLIOC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|