C36H64N2O7 — CID 21348313
6-O-[2,2,6,6-tetramethyl-1-[2-(6-oxoheptanoyloxy)ethyl]piperidin-4-yl] 1-O-(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) hexanedioate (PubChem CID 21348313) has the molecular formula C36H64N2O7 and a molecular weight of 636.91 g/mol. Its IUPAC name is 6-O-[2,2,6,6-tetramethyl-1-[2-(6-oxoheptanoyloxy)ethyl]piperidin-4-yl] 1-O-(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) hexanedioate.
| Compound Name | 6-O-[2,2,6,6-tetramethyl-1-[2-(6-oxoheptanoyloxy)ethyl]piperidin-4-yl] 1-O-(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) hexanedioate |
|---|---|
| PubChem CID | 21348313 |
| Molecular Formula | C36H64N2O7 |
| Molecular Weight | 636.91 g/mol |
| Exact Mass | 636.47 |
| IUPAC Name | 6-O-[2,2,6,6-tetramethyl-1-[2-(6-oxoheptanoyloxy)ethyl]piperidin-4-yl] 1-O-(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) hexanedioate |
| SMILES | CCCN1C(C)(C)CC(OC(=O)CCCCC(=O)OC2CC(C)(C)N(CCOC(=O)CCCCC(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C36H64N2O7/c1-11-20-37-33(3,4)23-28(24-34(37,5)6)44-31(41)18-14-15-19-32(42)45-29-25-35(7,8)38(36(9,10)26-29)21-22-43-30(40)17-13-12-16-27(2)39/h28-29H,11-26H2,1-10H3 |
| InChIKey | RWOUBMRRYASDOQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.91 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|