About dimethyl 2-ethyl-2,4-dimethylpentanedioate
dimethyl 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 21348330) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is dimethyl 2-ethyl-2,4-dimethylpentanedioate.
Molecular Properties
| Compound Name | dimethyl 2-ethyl-2,4-dimethylpentanedioate |
| PubChem CID | 21348330 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | dimethyl 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C11H20O4/c1-6-11(3,10(13)15-5)7-8(2)9(12)14-4/h8H,6-7H2,1-5H3 |
| InChIKey | BGMRKKAQEXLSPL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 2-ethyl-2,4-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-ethyl-2,4-dimethylpentanedioate?
The IUPAC name of dimethyl 2-ethyl-2,4-dimethylpentanedioate (CID 21348330) is dimethyl 2-ethyl-2,4-dimethylpentanedioate.
What is the SMILES notation for dimethyl 2-ethyl-2,4-dimethylpentanedioate?
The canonical SMILES for dimethyl 2-ethyl-2,4-dimethylpentanedioate is CCC(C)(CC(C)C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-ethyl-2,4-dimethylpentanedioate?
The InChIKey is BGMRKKAQEXLSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-6-11(3,10(13)15-5)7-8(2)9(12)14-4/h8H,6-7H2,1-5H3.
What are the key properties of dimethyl 2-ethyl-2,4-dimethylpentanedioate?
dimethyl 2-ethyl-2,4-dimethylpentanedioate has a molecular weight of 216.28 g/mol, XLogP of 1.77, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-ethyl-2,4-dimethylpentanedioate is sourced from PubChem (CID 21348330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).