C9H18N4 — CID 21348459
2-methyl-2-N-methylidene-1-piperazin-1-ylpropane-1,2-diimine (PubChem CID 21348459) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methyl-2-N-methylidene-1-piperazin-1-ylpropane-1,2-diimine.
| Compound Name | 2-methyl-2-N-methylidene-1-piperazin-1-ylpropane-1,2-diimine |
|---|---|
| PubChem CID | 21348459 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-methyl-2-N-methylidene-1-piperazin-1-ylpropane-1,2-diimine |
| SMILES | [H]/N=C(\N1CCNCC1)C(C)(C)N=C |
| InChI | InChI=1S/C9H18N4/c1-9(2,11-3)8(10)13-6-4-12-5-7-13/h10,12H,3-7H2,1-2H3/b10-8- |
| InChIKey | LRNMHVPYRIBBAL-NTMALXAHSA-N |
| XLogP | 0.35 |
| TPSA | 51.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|