C32H28N4O3 — CID 21349107
N-[[5-[4-(dimethylamino)phenyl]-6-phenyl-2,3-dihydro-1,4-dioxin-2-yl]methyl]-1,10-phenanthroline-2-carboxamide (PubChem CID 21349107) has the molecular formula C32H28N4O3 and a molecular weight of 516.60 g/mol. Its IUPAC name is N-[[5-[4-(dimethylamino)phenyl]-6-phenyl-2,3-dihydro-1,4-dioxin-2-yl]methyl]-1,10-phenanthroline-2-carboxamide.
| Compound Name | N-[[5-[4-(dimethylamino)phenyl]-6-phenyl-2,3-dihydro-1,4-dioxin-2-yl]methyl]-1,10-phenanthroline-2-carboxamide |
|---|---|
| PubChem CID | 21349107 |
| Molecular Formula | C32H28N4O3 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[[5-[4-(dimethylamino)phenyl]-6-phenyl-2,3-dihydro-1,4-dioxin-2-yl]methyl]-1,10-phenanthroline-2-carboxamide |
| SMILES | CN(C)c1ccc(C2=C(c3ccccc3)OC(CNC(=O)c3ccc4ccc5cccnc5c4n3)CO2)cc1 |
| InChI | InChI=1S/C32H28N4O3/c1-36(2)25-15-12-24(13-16-25)30-31(23-7-4-3-5-8-23)39-26(20-38-30)19-34-32(37)27-17-14-22-11-10-21-9-6-18-33-28(21)29(22)35-27/h3-18,26H,19-20H2,1-2H3,(H,34,37) |
| InChIKey | GVRFVYQGMTUKLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|