About 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene
5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene (PubChem CID 21349204) has the molecular formula C24H44O6
and a molecular weight of 428.61 g/mol. Its IUPAC name is 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene.
Molecular Properties
| Compound Name | 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene |
| PubChem CID | 21349204 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene |
| SMILES | C=CCCCOCCOCC(COCCOCCCC=C)OCCOCCCC=C |
| InChI | InChI=1S/C24H44O6/c1-4-7-10-13-25-16-18-28-22-24(30-21-20-27-15-12-9-6-3)23-29-19-17-26-14-11-8-5-2/h4-6,24H,1-3,7-23H2 |
| InChIKey | CHIAJLCOGKEAOS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene?
The IUPAC name of 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene (CID 21349204) is 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene.
What is the SMILES notation for 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene?
The canonical SMILES for 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene is C=CCCCOCCOCC(COCCOCCCC=C)OCCOCCCC=C.
What is the InChIKey of 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene?
The InChIKey is CHIAJLCOGKEAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O6/c1-4-7-10-13-25-16-18-28-22-24(30-21-20-27-15-12-9-6-3)23-29-19-17-26-14-11-8-5-2/h4-6,24H,1-3,7-23H2.
What are the key properties of 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene?
5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene has a molecular weight of 428.61 g/mol, XLogP of 4.35, 26 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[2,3-bis(2-pent-4-enoxyethoxy)propoxy]ethoxy]pent-1-ene is sourced from PubChem (CID 21349204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).