C18H24N6O4 — CID 21349422
N-[4-methyl-6-[1-[(4-nitrophenyl)methoxy]butan-2-ylamino]-1,3,5-triazin-2-yl]propanamide (PubChem CID 21349422) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[4-methyl-6-[1-[(4-nitrophenyl)methoxy]butan-2-ylamino]-1,3,5-triazin-2-yl]propanamide.
| Compound Name | N-[4-methyl-6-[1-[(4-nitrophenyl)methoxy]butan-2-ylamino]-1,3,5-triazin-2-yl]propanamide |
|---|---|
| PubChem CID | 21349422 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[4-methyl-6-[1-[(4-nitrophenyl)methoxy]butan-2-ylamino]-1,3,5-triazin-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nc(C)nc(NC(CC)COCc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H24N6O4/c1-4-14(11-28-10-13-6-8-15(9-7-13)24(26)27)21-17-19-12(3)20-18(23-17)22-16(25)5-2/h6-9,14H,4-5,10-11H2,1-3H3,(H2,19,20,21,22,23,25) |
| InChIKey | SQBJTOXFGUOQKP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 132.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|