About 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one
1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one (PubChem CID 2134967) has the molecular formula C25H19F2NO3
and a molecular weight of 419.43 g/mol. Its IUPAC name is 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one |
| PubChem CID | 2134967 |
| Molecular Formula | C25H19F2NO3 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one |
| SMILES | CCOc1ccc(C(=O)c2cn(Cc3ccccc3)c3c(F)cc(F)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H19F2NO3/c1-2-31-19-10-8-17(9-11-19)24(29)21-15-28(14-16-6-4-3-5-7-16)23-20(25(21)30)12-18(26)13-22(23)27/h3-13,15H,2,14H2,1H3 |
| InChIKey | UPIMUEVSXADSOE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one?
The IUPAC name of 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one (CID 2134967) is 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one.
What is the SMILES notation for 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one?
The canonical SMILES for 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one is CCOc1ccc(C(=O)c2cn(Cc3ccccc3)c3c(F)cc(F)cc3c2=O)cc1.
What is the InChIKey of 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one?
The InChIKey is UPIMUEVSXADSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19F2NO3/c1-2-31-19-10-8-17(9-11-19)24(29)21-15-28(14-16-6-4-3-5-7-16)23-20(25(21)30)12-18(26)13-22(23)27/h3-13,15H,2,14H2,1H3.
What are the key properties of 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one?
1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one has a molecular weight of 419.43 g/mol, XLogP of 4.96, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-(4-ethoxybenzoyl)-6,8-difluoroquinolin-4-one is sourced from PubChem (CID 2134967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).