C32H24N2O5 — CID 21350857
2,5-dimethyl-6-[6-methyl-2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione (PubChem CID 21350857) has the molecular formula C32H24N2O5 and a molecular weight of 516.55 g/mol. Its IUPAC name is 2,5-dimethyl-6-[6-methyl-2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione.
| Compound Name | 2,5-dimethyl-6-[6-methyl-2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21350857 |
| Molecular Formula | C32H24N2O5 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2,5-dimethyl-6-[6-methyl-2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4cc(C)c(-c5cc6c(cc5C)C(=O)N(C)C6=O)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C32H24N2O5/c1-17-5-9-21(10-6-17)39-22-11-7-20(8-12-22)34-31(37)26-14-19(3)24(16-28(26)32(34)38)23-15-27-25(13-18(23)2)29(35)33(4)30(27)36/h5-16H,1-4H3 |
| InChIKey | MAKPHFHEESQEBT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|