About (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene
(2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene (PubChem CID 21350906) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene.
Molecular Properties
| Compound Name | (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene |
| PubChem CID | 21350906 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/COC(C)C |
| InChI | InChI=1S/C13H24O/c1-11(2)7-6-8-13(5)9-10-14-12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9+ |
| InChIKey | ITQOWFLOOIUZRC-UKTHLTGXSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene?
The IUPAC name of (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene (CID 21350906) is (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene.
What is the SMILES notation for (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene?
The canonical SMILES for (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene is CC(C)=CCC/C(C)=C/COC(C)C.
What is the InChIKey of (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene?
The InChIKey is ITQOWFLOOIUZRC-UKTHLTGXSA-N. The full InChI is InChI=1S/C13H24O/c1-11(2)7-6-8-13(5)9-10-14-12(3)4/h7,9,12H,6,8,10H2,1-5H3/b13-9+.
What are the key properties of (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene?
(2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene has a molecular weight of 196.33 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethyl-1-propan-2-yloxyocta-2,6-diene is sourced from PubChem (CID 21350906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).