C33H32N4+2 — CID 21350961
5-[4-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-10-phenylphenazine (PubChem CID 21350961) has the molecular formula C33H32N4+2 and a molecular weight of 484.65 g/mol. Its IUPAC name is 5-[4-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-10-phenylphenazine.
| Compound Name | 5-[4-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-10-phenylphenazine |
|---|---|
| PubChem CID | 21350961 |
| Molecular Formula | C33H32N4+2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 5-[4-[4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium-1-yl]butyl]-10-phenylphenazine |
| SMILES | C[n+]1ccc(-c2cc[n+](CCCCN3c4ccccc4N(c4ccccc4)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C33H32N4/c1-34-23-17-27(18-24-34)28-19-25-35(26-20-28)21-9-10-22-36-30-13-5-7-15-32(30)37(29-11-3-2-4-12-29)33-16-8-6-14-31(33)36/h2-8,11-20,23-26H,9-10,21-22H2,1H3/q+2 |
| InChIKey | NLFAFNHOTSKQPG-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|