C11H16O — CID 21351126
(3E,5E,7E)-2-(methoxymethyl)nona-1,3,5,7-tetraene (PubChem CID 21351126) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (3E,5E,7E)-2-(methoxymethyl)nona-1,3,5,7-tetraene.
| Compound Name | (3E,5E,7E)-2-(methoxymethyl)nona-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 21351126 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (3E,5E,7E)-2-(methoxymethyl)nona-1,3,5,7-tetraene |
| SMILES | C=C(/C=C/C=C/C=C/C)COC |
| InChI | InChI=1S/C11H16O/c1-4-5-6-7-8-9-11(2)10-12-3/h4-9H,2,10H2,1,3H3/b5-4+,7-6+,9-8+ |
| InChIKey | ZXAGZBSLYMVNAN-ZAJAATJQSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|