C29H35K2N7O7S2 — CID 21351193
dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyano-3-propan-2-ylpyrazol-1-yl]-3,5-dimethylbenzenesulfonate (PubChem CID 21351193) has the molecular formula C29H35K2N7O7S2 and a molecular weight of 735.97 g/mol. Its IUPAC name is dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyano-3-propan-2-ylpyrazol-1-yl]-3,5-dimethylbenzenesulfonate.
| Compound Name | dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyano-3-propan-2-ylpyrazol-1-yl]-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 21351193 |
| Molecular Formula | C29H35K2N7O7S2 |
| Molecular Weight | 735.97 g/mol |
| Exact Mass | 735.13 |
| IUPAC Name | dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyano-3-propan-2-ylpyrazol-1-yl]-3,5-dimethylbenzenesulfonate |
| SMILES | CCN(CCCCS(=O)(=O)[O-])c1ccc(/N=N/c2c(C#N)c(C(C)C)nn2-c2c(C)cc(S(=O)(=O)[O-])cc2C)c(NC(C)=O)c1.[K+].[K+] |
| InChI | InChI=1S/C29H37N7O7S2.2K/c1-7-35(12-8-9-13-44(38,39)40)22-10-11-25(26(16-22)31-21(6)37)32-33-29-24(17-30)27(18(2)3)34-36(29)28-19(4)14-23(15-20(28)5)45(41,42)43;;/h10-11,14-16,18H,7-9,12-13H2,1-6H3,(H,31,37)(H,38,39,40)(H,41,42,43);;/q;2*+1/p-2/b33-32+;; |
| InChIKey | PXWGINOGMVWWLF-BZAYTVMESA-L |
| XLogP | -1.08 |
| TPSA | 213.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.97 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|