About (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate
(1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate (PubChem CID 21351452) has the molecular formula C24H42O4
and a molecular weight of 394.60 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate |
| PubChem CID | 21351452 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate |
| SMILES | CCC1CC(CC)C(C(CC(=O)OC2(CC)CCCC2)OC2CCCCO2)C1 |
| InChI | InChI=1S/C24H42O4/c1-4-18-15-19(5-2)20(16-18)21(27-23-11-7-10-14-26-23)17-22(25)28-24(6-3)12-8-9-13-24/h18-21,23H,4-17H2,1-3H3 |
| InChIKey | MJDTZQGVCSVRLO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate?
The IUPAC name of (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate (CID 21351452) is (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate.
What is the SMILES notation for (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate?
The canonical SMILES for (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate is CCC1CC(CC)C(C(CC(=O)OC2(CC)CCCC2)OC2CCCCO2)C1.
What is the InChIKey of (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate?
The InChIKey is MJDTZQGVCSVRLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O4/c1-4-18-15-19(5-2)20(16-18)21(27-23-11-7-10-14-26-23)17-22(25)28-24(6-3)12-8-9-13-24/h18-21,23H,4-17H2,1-3H3.
What are the key properties of (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate?
(1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate has a molecular weight of 394.60 g/mol, XLogP of 6.02, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 3-(2,4-diethylcyclopentyl)-3-(oxan-2-yloxy)propanoate is sourced from PubChem (CID 21351452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).