C24H40O7 — CID 21351543
1-ethoxyethyl 3-(3,5-diethyl-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl)-3-(oxan-2-yloxy)propanoate (PubChem CID 21351543) has the molecular formula C24H40O7 and a molecular weight of 440.58 g/mol. Its IUPAC name is 1-ethoxyethyl 3-(3,5-diethyl-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl)-3-(oxan-2-yloxy)propanoate.
| Compound Name | 1-ethoxyethyl 3-(3,5-diethyl-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl)-3-(oxan-2-yloxy)propanoate |
|---|---|
| PubChem CID | 21351543 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-ethoxyethyl 3-(3,5-diethyl-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl)-3-(oxan-2-yloxy)propanoate |
| SMILES | CCOC(C)OC(=O)CC(OC1CCCCO1)C1CC2OC1C1C(CC)OC(CC)C21 |
| InChI | InChI=1S/C24H40O7/c1-5-16-22-19-12-15(24(31-19)23(22)17(6-2)29-16)18(30-21-10-8-9-11-27-21)13-20(25)28-14(4)26-7-3/h14-19,21-24H,5-13H2,1-4H3 |
| InChIKey | UZNYEKHAHCASFM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|