About 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid
3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 21351604) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid.
Molecular Properties
| Compound Name | 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| PubChem CID | 21351604 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | CCC1CC(CC)C2C3CC(C(COC)C3C(=O)O)C12 |
| InChI | InChI=1S/C17H28O3/c1-4-9-6-10(5-2)15-12-7-11(14(9)15)13(8-20-3)16(12)17(18)19/h9-16H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | YYEOVLQYKVOMOE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid?
The IUPAC name of 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid (CID 21351604) is 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid.
What is the SMILES notation for 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid?
The canonical SMILES for 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid is CCC1CC(CC)C2C3CC(C(COC)C3C(=O)O)C12.
What is the InChIKey of 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid?
The InChIKey is YYEOVLQYKVOMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3/c1-4-9-6-10(5-2)15-12-7-11(14(9)15)13(8-20-3)16(12)17(18)19/h9-16H,4-8H2,1-3H3,(H,18,19).
What are the key properties of 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid?
3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid has a molecular weight of 280.41 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-9-(methoxymethyl)tricyclo[5.2.1.02,6]decane-8-carboxylic acid is sourced from PubChem (CID 21351604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).