C15H8F15NO3S — CID 21351665
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(4-methylphenyl)sulfonyloctanamide (PubChem CID 21351665) has the molecular formula C15H8F15NO3S and a molecular weight of 567.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(4-methylphenyl)sulfonyloctanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(4-methylphenyl)sulfonyloctanamide |
|---|---|
| PubChem CID | 21351665 |
| Molecular Formula | C15H8F15NO3S |
| Molecular Weight | 567.27 g/mol |
| Exact Mass | 567.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(4-methylphenyl)sulfonyloctanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8F15NO3S/c1-6-2-4-7(5-3-6)35(33,34)31-8(32)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h2-5H,1H3,(H,31,32) |
| InChIKey | RIWUQESKNCCGHF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|