C17H36O8S — CID 21351862
2-[2-[2-(2-nonoxyethoxy)ethoxy]ethoxy]ethyl hydrogen sulfate (PubChem CID 21351862) has the molecular formula C17H36O8S and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[2-[2-(2-nonoxyethoxy)ethoxy]ethoxy]ethyl hydrogen sulfate.
| Compound Name | 2-[2-[2-(2-nonoxyethoxy)ethoxy]ethoxy]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 21351862 |
| Molecular Formula | C17H36O8S |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[2-[2-(2-nonoxyethoxy)ethoxy]ethoxy]ethyl hydrogen sulfate |
| SMILES | CCCCCCCCCOCCOCCOCCOCCOS(=O)(=O)O |
| InChI | InChI=1S/C17H36O8S/c1-2-3-4-5-6-7-8-9-21-10-11-22-12-13-23-14-15-24-16-17-25-26(18,19)20/h2-17H2,1H3,(H,18,19,20) |
| InChIKey | ZFQIRWNQUXJHDS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|