C14H26O7 — CID 21352011
(2R,3R,4S,5R)-1,2,3,4,5-pentahydroxytetradecane-6,7-dione (PubChem CID 21352011) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2R,3R,4S,5R)-1,2,3,4,5-pentahydroxytetradecane-6,7-dione.
| Compound Name | (2R,3R,4S,5R)-1,2,3,4,5-pentahydroxytetradecane-6,7-dione |
|---|---|
| PubChem CID | 21352011 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R,3R,4S,5R)-1,2,3,4,5-pentahydroxytetradecane-6,7-dione |
| SMILES | CCCCCCCC(=O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H26O7/c1-2-3-4-5-6-7-9(16)11(18)13(20)14(21)12(19)10(17)8-15/h10,12-15,17,19-21H,2-8H2,1H3/t10-,12-,13+,14+/m1/s1 |
| InChIKey | BJLLRGIKYIJCAL-ZZVYKPCYSA-N |
| XLogP | -1.08 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|