C33H58O14 — CID 21352013
[8-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-7,9-dioxopentadecan-8-yl] heptanoate (PubChem CID 21352013) has the molecular formula C33H58O14 and a molecular weight of 678.81 g/mol. Its IUPAC name is [8-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-7,9-dioxopentadecan-8-yl] heptanoate.
| Compound Name | [8-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-7,9-dioxopentadecan-8-yl] heptanoate |
|---|---|
| PubChem CID | 21352013 |
| Molecular Formula | C33H58O14 |
| Molecular Weight | 678.81 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | [8-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]-7,9-dioxopentadecan-8-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC(C(=O)CCCCCC)(C(=O)CCCCCC)[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H58O14/c1-4-7-10-13-16-23(36)32(24(37)17-14-11-8-5-2,46-25(38)18-15-12-9-6-3)33(30(43)27(40)22(20-35)45-33)47-31-29(42)28(41)26(39)21(19-34)44-31/h21-22,26-31,34-35,39-43H,4-20H2,1-3H3/t21-,22-,26-,27-,28+,29-,30+,31-,33-/m1/s1 |
| InChIKey | CXAZAIZVFYXHNM-AMXPRYKQSA-N |
| XLogP | 0.94 |
| TPSA | 229.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.81 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|