About 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one
1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one (PubChem CID 21352300) has the molecular formula C22H28N2O2
and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one |
| PubChem CID | 21352300 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one |
| SMILES | Cc1cc(-c2cc(CN3CCC(=O)CC3)ccn2)cc(C)c1OC(C)C |
| InChI | InChI=1S/C22H28N2O2/c1-15(2)26-22-16(3)11-19(12-17(22)4)21-13-18(5-8-23-21)14-24-9-6-20(25)7-10-24/h5,8,11-13,15H,6-7,9-10,14H2,1-4H3 |
| InChIKey | BUWBKHBKLOCFPQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one?
The IUPAC name of 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one (CID 21352300) is 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one.
What is the SMILES notation for 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one?
The canonical SMILES for 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one is Cc1cc(-c2cc(CN3CCC(=O)CC3)ccn2)cc(C)c1OC(C)C.
What is the InChIKey of 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one?
The InChIKey is BUWBKHBKLOCFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O2/c1-15(2)26-22-16(3)11-19(12-17(22)4)21-13-18(5-8-23-21)14-24-9-6-20(25)7-10-24/h5,8,11-13,15H,6-7,9-10,14H2,1-4H3.
What are the key properties of 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one?
1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one has a molecular weight of 352.48 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(3,5-dimethyl-4-propan-2-yloxyphenyl)-4-pyridinyl]methyl]piperidin-4-one is sourced from PubChem (CID 21352300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).